C22H21N5O2 — CID 2550913
1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxyethanone (PubChem CID 2550913) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxyethanone.
| Compound Name | 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxyethanone |
|---|---|
| PubChem CID | 2550913 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxyethanone |
| SMILES | C=CCn1c(C)cc(C(=O)COc2ncnc3c2cnn3-c2ccccc2)c1C |
| InChI | InChI=1S/C22H21N5O2/c1-4-10-26-15(2)11-18(16(26)3)20(28)13-29-22-19-12-25-27(21(19)23-14-24-22)17-8-6-5-7-9-17/h4-9,11-12,14H,1,10,13H2,2-3H3 |
| InChIKey | DRBSDADWFNTNJX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|