C20H23BrN4O3 — CID 2555298
(2R)-N-(4-acetamidophenyl)-2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]propanamide (PubChem CID 2555298) has the molecular formula C20H23BrN4O3 and a molecular weight of 447.33 g/mol. Its IUPAC name is (2R)-N-(4-acetamidophenyl)-2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]propanamide.
| Compound Name | (2R)-N-(4-acetamidophenyl)-2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 2555298 |
| Molecular Formula | C20H23BrN4O3 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (2R)-N-(4-acetamidophenyl)-2-[[2-(2-bromoanilino)-2-oxoethyl]-methylamino]propanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)N(C)CC(=O)Nc2ccccc2Br)cc1 |
| InChI | InChI=1S/C20H23BrN4O3/c1-13(20(28)23-16-10-8-15(9-11-16)22-14(2)26)25(3)12-19(27)24-18-7-5-4-6-17(18)21/h4-11,13H,12H2,1-3H3,(H,22,26)(H,23,28)(H,24,27)/t13-/m1/s1 |
| InChIKey | WCBODZYZPFVCEB-CYBMUJFWSA-N |
| XLogP | 3.31 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |