C23H23NO4S — CID 2555967
5-(3,3-diphenylpropylsulfamoyl)-2-methylbenzoic acid (PubChem CID 2555967) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-(3,3-diphenylpropylsulfamoyl)-2-methylbenzoic acid.
| Compound Name | 5-(3,3-diphenylpropylsulfamoyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 2555967 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 5-(3,3-diphenylpropylsulfamoyl)-2-methylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(c2ccccc2)c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C23H23NO4S/c1-17-12-13-20(16-22(17)23(25)26)29(27,28)24-15-14-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-13,16,21,24H,14-15H2,1H3,(H,25,26) |
| InChIKey | XMLWZCBHDDZTKZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |