C24H27NO4S — CID 10093928
3-[4-(benzenesulfonamido)butyl]-6-propan-2-ylazulene-1-carboxylic acid (PubChem CID 10093928) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-[4-(benzenesulfonamido)butyl]-6-propan-2-ylazulene-1-carboxylic acid.
| Compound Name | 3-[4-(benzenesulfonamido)butyl]-6-propan-2-ylazulene-1-carboxylic acid |
|---|---|
| PubChem CID | 10093928 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-[4-(benzenesulfonamido)butyl]-6-propan-2-ylazulene-1-carboxylic acid |
| SMILES | CC(C)c1ccc2c(CCCCNS(=O)(=O)c3ccccc3)cc(C(=O)O)c-2cc1 |
| InChI | InChI=1S/C24H27NO4S/c1-17(2)18-11-13-21-19(16-23(24(26)27)22(21)14-12-18)8-6-7-15-25-30(28,29)20-9-4-3-5-10-20/h3-5,9-14,16-17,25H,6-8,15H2,1-2H3,(H,26,27) |
| InChIKey | NABDGKYIEDLLPV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|