C25H29NO4S — CID 10343155
3-[8-(benzenesulfonamido)octyl]azulene-1-carboxylic acid (PubChem CID 10343155) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-[8-(benzenesulfonamido)octyl]azulene-1-carboxylic acid.
| Compound Name | 3-[8-(benzenesulfonamido)octyl]azulene-1-carboxylic acid |
|---|---|
| PubChem CID | 10343155 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[8-(benzenesulfonamido)octyl]azulene-1-carboxylic acid |
| SMILES | O=C(O)c1cc(CCCCCCCCNS(=O)(=O)c2ccccc2)c2cccccc1-2 |
| InChI | InChI=1S/C25H29NO4S/c27-25(28)24-19-20(22-16-10-6-11-17-23(22)24)13-7-3-1-2-4-12-18-26-31(29,30)21-14-8-5-9-15-21/h5-6,8-11,14-17,19,26H,1-4,7,12-13,18H2,(H,27,28) |
| InChIKey | BIVLGCFIERNVTP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|