C25H29NO5S — CID 10253507
3-[4-[(4-methoxyphenyl)sulfonylamino]butyl]-6-propan-2-ylazulene-1-carboxylic acid (PubChem CID 10253507) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is 3-[4-[(4-methoxyphenyl)sulfonylamino]butyl]-6-propan-2-ylazulene-1-carboxylic acid.
| Compound Name | 3-[4-[(4-methoxyphenyl)sulfonylamino]butyl]-6-propan-2-ylazulene-1-carboxylic acid |
|---|---|
| PubChem CID | 10253507 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 3-[4-[(4-methoxyphenyl)sulfonylamino]butyl]-6-propan-2-ylazulene-1-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)NCCCCc2cc(C(=O)O)c3ccc(C(C)C)ccc2-3)cc1 |
| InChI | InChI=1S/C25H29NO5S/c1-17(2)18-7-13-22-19(16-24(25(27)28)23(22)14-8-18)6-4-5-15-26-32(29,30)21-11-9-20(31-3)10-12-21/h7-14,16-17,26H,4-6,15H2,1-3H3,(H,27,28) |
| InChIKey | BMKWNOHATXYDKX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|