C23H25NO4S — CID 10476737
3-[6-(benzenesulfonamido)hexyl]azulene-1-carboxylic acid (PubChem CID 10476737) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is 3-[6-(benzenesulfonamido)hexyl]azulene-1-carboxylic acid.
| Compound Name | 3-[6-(benzenesulfonamido)hexyl]azulene-1-carboxylic acid |
|---|---|
| PubChem CID | 10476737 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-[6-(benzenesulfonamido)hexyl]azulene-1-carboxylic acid |
| SMILES | O=C(O)c1cc(CCCCCCNS(=O)(=O)c2ccccc2)c2cccccc1-2 |
| InChI | InChI=1S/C23H25NO4S/c25-23(26)22-17-18(20-14-8-4-9-15-21(20)22)11-5-1-2-10-16-24-29(27,28)19-12-6-3-7-13-19/h3-4,6-9,12-15,17,24H,1-2,5,10-11,16H2,(H,25,26) |
| InChIKey | NMFNUBPGMDEVTK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|