C27H33NO4S — CID 10027602
3-[7-(benzenesulfonamido)heptyl]-6-propan-2-ylazulene-1-carboxylic acid (PubChem CID 10027602) has the molecular formula C27H33NO4S and a molecular weight of 467.63 g/mol. Its IUPAC name is 3-[7-(benzenesulfonamido)heptyl]-6-propan-2-ylazulene-1-carboxylic acid.
| Compound Name | 3-[7-(benzenesulfonamido)heptyl]-6-propan-2-ylazulene-1-carboxylic acid |
|---|---|
| PubChem CID | 10027602 |
| Molecular Formula | C27H33NO4S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-[7-(benzenesulfonamido)heptyl]-6-propan-2-ylazulene-1-carboxylic acid |
| SMILES | CC(C)c1ccc2c(CCCCCCCNS(=O)(=O)c3ccccc3)cc(C(=O)O)c-2cc1 |
| InChI | InChI=1S/C27H33NO4S/c1-20(2)21-14-16-24-22(19-26(27(29)30)25(24)17-15-21)11-7-4-3-5-10-18-28-33(31,32)23-12-8-6-9-13-23/h6,8-9,12-17,19-20,28H,3-5,7,10-11,18H2,1-2H3,(H,29,30) |
| InChIKey | XCARIGILPOERCX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|