C21H21NO4S — CID 10362543
3-[4-(benzenesulfonamido)butyl]azulene-1-carboxylic acid (PubChem CID 10362543) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-[4-(benzenesulfonamido)butyl]azulene-1-carboxylic acid.
| Compound Name | 3-[4-(benzenesulfonamido)butyl]azulene-1-carboxylic acid |
|---|---|
| PubChem CID | 10362543 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-[4-(benzenesulfonamido)butyl]azulene-1-carboxylic acid |
| SMILES | O=C(O)c1cc(CCCCNS(=O)(=O)c2ccccc2)c2cccccc1-2 |
| InChI | InChI=1S/C21H21NO4S/c23-21(24)20-15-16(18-12-5-2-6-13-19(18)20)9-7-8-14-22-27(25,26)17-10-3-1-4-11-17/h1-6,10-13,15,22H,7-9,14H2,(H,23,24) |
| InChIKey | MRHWMBMFSCOPDZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|