C24H26FNO4S — CID 10072108
3-[4-[(4-fluorophenyl)sulfonylamino]butyl]-6-propan-2-ylazulene-1-carboxylic acid (PubChem CID 10072108) has the molecular formula C24H26FNO4S and a molecular weight of 443.54 g/mol. Its IUPAC name is 3-[4-[(4-fluorophenyl)sulfonylamino]butyl]-6-propan-2-ylazulene-1-carboxylic acid.
| Compound Name | 3-[4-[(4-fluorophenyl)sulfonylamino]butyl]-6-propan-2-ylazulene-1-carboxylic acid |
|---|---|
| PubChem CID | 10072108 |
| Molecular Formula | C24H26FNO4S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 3-[4-[(4-fluorophenyl)sulfonylamino]butyl]-6-propan-2-ylazulene-1-carboxylic acid |
| SMILES | CC(C)c1ccc2c(CCCCNS(=O)(=O)c3ccc(F)cc3)cc(C(=O)O)c-2cc1 |
| InChI | InChI=1S/C24H26FNO4S/c1-16(2)17-6-12-21-18(15-23(24(27)28)22(21)13-7-17)5-3-4-14-26-31(29,30)20-10-8-19(25)9-11-20/h6-13,15-16,26H,3-5,14H2,1-2H3,(H,27,28) |
| InChIKey | NMFOFAKOZUXHEU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|