C24H27NO4S — CID 10251830
3-[7-(benzenesulfonamido)heptyl]azulene-1-carboxylic acid (PubChem CID 10251830) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-[7-(benzenesulfonamido)heptyl]azulene-1-carboxylic acid.
| Compound Name | 3-[7-(benzenesulfonamido)heptyl]azulene-1-carboxylic acid |
|---|---|
| PubChem CID | 10251830 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-[7-(benzenesulfonamido)heptyl]azulene-1-carboxylic acid |
| SMILES | O=C(O)c1cc(CCCCCCCNS(=O)(=O)c2ccccc2)c2cccccc1-2 |
| InChI | InChI=1S/C24H27NO4S/c26-24(27)23-18-19(21-15-9-5-10-16-22(21)23)12-6-2-1-3-11-17-25-30(28,29)20-13-7-4-8-14-20/h4-5,7-10,13-16,18,25H,1-3,6,11-12,17H2,(H,26,27) |
| InChIKey | IMHLAEYEOCNFEF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|