C24H28N2OS — CID 2557724
4-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-(4-methoxyphenyl)-1,3-thiazole (PubChem CID 2557724) has the molecular formula C24H28N2OS and a molecular weight of 392.57 g/mol. Its IUPAC name is 4-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-(4-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-(4-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 2557724 |
| Molecular Formula | C24H28N2OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-[1-[2-(cyclohexen-1-yl)ethyl]-2,5-dimethylpyrrol-3-yl]-2-(4-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(-c3cc(C)n(CCC4=CCCCC4)c3C)cs2)cc1 |
| InChI | InChI=1S/C24H28N2OS/c1-17-15-22(18(2)26(17)14-13-19-7-5-4-6-8-19)23-16-28-24(25-23)20-9-11-21(27-3)12-10-20/h7,9-12,15-16H,4-6,8,13-14H2,1-3H3 |
| InChIKey | PVNMAWWHIYAMPV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|