About 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one
3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one (PubChem CID 2561852) has the molecular formula C23H18N4OS2
and a molecular weight of 430.56 g/mol. Its IUPAC name is 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one |
| PubChem CID | 2561852 |
| Molecular Formula | C23H18N4OS2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one |
| SMILES | Cc1sc2ncnc(Sc3nc4ccccc4c(=O)n3Cc3ccccc3)c2c1C |
| InChI | InChI=1S/C23H18N4OS2/c1-14-15(2)29-20-19(14)21(25-13-24-20)30-23-26-18-11-7-6-10-17(18)22(28)27(23)12-16-8-4-3-5-9-16/h3-11,13H,12H2,1-2H3 |
| InChIKey | RGMGFLSCQFJJRT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one?
The IUPAC name of 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one (CID 2561852) is 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one.
What is the SMILES notation for 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one?
The canonical SMILES for 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one is Cc1sc2ncnc(Sc3nc4ccccc4c(=O)n3Cc3ccccc3)c2c1C.
What is the InChIKey of 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one?
The InChIKey is RGMGFLSCQFJJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N4OS2/c1-14-15(2)29-20-19(14)21(25-13-24-20)30-23-26-18-11-7-6-10-17(18)22(28)27(23)12-16-8-4-3-5-9-16/h3-11,13H,12H2,1-2H3.
What are the key properties of 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one?
3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one has a molecular weight of 430.56 g/mol, XLogP of 5.22, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylquinazolin-4-one is sourced from PubChem (CID 2561852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).