C26H30N4O2S3 — CID 2562813
3-cyclohexyl-2-[(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2562813) has the molecular formula C26H30N4O2S3 and a molecular weight of 526.75 g/mol. Its IUPAC name is 3-cyclohexyl-2-[(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-cyclohexyl-2-[(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2562813 |
| Molecular Formula | C26H30N4O2S3 |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 3-cyclohexyl-2-[(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc([C@@H](C)Sc3nc4sc5c(c4c(=O)n3C3CCCCC3)CCCC5)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C26H30N4O2S3/c1-13-14(2)33-23-19(13)22(31)27-21(28-23)15(3)34-26-29-24-20(17-11-7-8-12-18(17)35-24)25(32)30(26)16-9-5-4-6-10-16/h15-16H,4-12H2,1-3H3,(H,27,28,31)/t15-/m1/s1 |
| InChIKey | PNDHTCKMFYOLOX-OAHLLOKOSA-N |
| XLogP | 6.61 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |