C15H12N2O5S — CID 2564867
2-[(3-nitro-4-phenylsulfanylbenzoyl)amino]acetic acid (PubChem CID 2564867) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is 2-[(3-nitro-4-phenylsulfanylbenzoyl)amino]acetic acid.
| Compound Name | 2-[(3-nitro-4-phenylsulfanylbenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 2564867 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-[(3-nitro-4-phenylsulfanylbenzoyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(Sc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12N2O5S/c18-14(19)9-16-15(20)10-6-7-13(12(8-10)17(21)22)23-11-4-2-1-3-5-11/h1-8H,9H2,(H,16,20)(H,18,19) |
| InChIKey | GINPJYJLUUIRML-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|