C17H25N3O4S — CID 4246093
N-butyl-4-[2-(diethylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 4246093) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-butyl-4-[2-(diethylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | N-butyl-4-[2-(diethylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4246093 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-butyl-4-[2-(diethylamino)-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | CCCCNC(=O)c1ccc(SCC(=O)N(CC)CC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H25N3O4S/c1-4-7-10-18-17(22)13-8-9-15(14(11-13)20(23)24)25-12-16(21)19(5-2)6-3/h8-9,11H,4-7,10,12H2,1-3H3,(H,18,22) |
| InChIKey | VCAWVAPJTRWDEX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|