C20H31FN3O+ — CID 2565316
(2R)-N-(cyclohexylmethyl)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 2565316) has the molecular formula C20H31FN3O+ and a molecular weight of 348.49 g/mol. Its IUPAC name is (2R)-N-(cyclohexylmethyl)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(cyclohexylmethyl)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 2565316 |
| Molecular Formula | C20H31FN3O+ |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (2R)-N-(cyclohexylmethyl)-2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NCC1CCCCC1)[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H30FN3O/c1-16(20(25)22-15-17-7-3-2-4-8-17)23-11-13-24(14-12-23)19-10-6-5-9-18(19)21/h5-6,9-10,16-17H,2-4,7-8,11-15H2,1H3,(H,22,25)/p+1/t16-/m1/s1 |
| InChIKey | UAROLSAJBWOGHU-MRXNPFEDSA-O |
| XLogP | 1.62 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |