C19H28ClFN2O — CID 110184358
3-cyclohexyl-1-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-1-one chloride (PubChem CID 110184358) has the molecular formula C19H28ClFN2O and a molecular weight of 354.90 g/mol. Its IUPAC name is 3-cyclohexyl-1-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-1-one chloride.
| Compound Name | 3-cyclohexyl-1-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-1-one chloride |
|---|---|
| PubChem CID | 110184358 |
| Molecular Formula | C19H28ClFN2O |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3-cyclohexyl-1-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-1-one chloride |
| SMILES | O=C(CCC1CCCCC1)[NH+]1CCN(c2ccccc2F)CC1.[Cl-] |
| InChI | InChI=1S/C19H27FN2O.ClH/c20-17-8-4-5-9-18(17)21-12-14-22(15-13-21)19(23)11-10-16-6-2-1-3-7-16;/h4-5,8-9,16H,1-3,6-7,10-15H2;1H |
| InChIKey | LAMUSGDKMFKGKP-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |