C10H13N3S — CID 2566124
4-(1,2,5-trimethylpyrrol-3-yl)-1,3-thiazol-2-amine (PubChem CID 2566124) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 4-(1,2,5-trimethylpyrrol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1,2,5-trimethylpyrrol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2566124 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4-(1,2,5-trimethylpyrrol-3-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(-c2csc(N)n2)c(C)n1C |
| InChI | InChI=1S/C10H13N3S/c1-6-4-8(7(2)13(6)3)9-5-14-10(11)12-9/h4-5H,1-3H3,(H2,11,12) |
| InChIKey | HYEVYINJVDHXMC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |