C28H30N3O2S+ — CID 2566897
2-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methylsulfanyl]-3-(4-ethylphenyl)quinazolin-4-one (PubChem CID 2566897) has the molecular formula C28H30N3O2S+ and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methylsulfanyl]-3-(4-ethylphenyl)quinazolin-4-one.
| Compound Name | 2-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methylsulfanyl]-3-(4-ethylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2566897 |
| Molecular Formula | C28H30N3O2S+ |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methylsulfanyl]-3-(4-ethylphenyl)quinazolin-4-one |
| SMILES | CCc1ccc(-n2c(SC[C@H]3C[NH+](Cc4ccccc4)CCO3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C28H29N3O2S/c1-2-21-12-14-23(15-13-21)31-27(32)25-10-6-7-11-26(25)29-28(31)34-20-24-19-30(16-17-33-24)18-22-8-4-3-5-9-22/h3-15,24H,2,16-20H2,1H3/p+1/t24-/m1/s1 |
| InChIKey | GLCHCAKVWJHXTD-XMMPIXPASA-O |
| XLogP | 3.52 |
| TPSA | 48.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |