C17H12N4O2S2 — CID 2567187
2-(4-oxoquinazolin-3-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 2567187) has the molecular formula C17H12N4O2S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-(4-oxoquinazolin-3-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-oxoquinazolin-3-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2567187 |
| Molecular Formula | C17H12N4O2S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-(4-oxoquinazolin-3-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C17H12N4O2S2/c22-15(20-17-19-13(9-25-17)14-6-3-7-24-14)8-21-10-18-12-5-2-1-4-11(12)16(21)23/h1-7,9-10H,8H2,(H,19,20,22) |
| InChIKey | HLJWPBYJLKSDEC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |