C25H18N4O2S — CID 26177375
N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 26177375) has the molecular formula C25H18N4O2S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 26177375 |
| Molecular Formula | C25H18N4O2S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)Nc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C25H18N4O2S/c30-21(15-29-16-26-20-14-8-7-13-19(20)24(29)31)27-25-28-22(17-9-3-1-4-10-17)23(32-25)18-11-5-2-6-12-18/h1-14,16H,15H2,(H,27,28,30) |
| InChIKey | ADJODKYKVSQXNL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |