[(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate

C12H7Cl2NO2S — CID 2568555

IUPAC[(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate
SMILESC[C@H](C#N)OC(=O)c1sc2cc(Cl)ccc2c1Cl
InChIInChI=1S/C12H7Cl2NO2S/c1-6(5-15)17-12(16)11-10(14)8-3-2-7(13)4-9(8)18-11/h2-4,6H,1H3/t6-/m1/s1
InChIKeyGRGFDTOQYIPCQY-ZCFIWIBFSA-N
MW300.17 g/mol
LogP4.28
Rot. Bonds2

About [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate

[(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 2568555) has the molecular formula C12H7Cl2NO2S and a molecular weight of 300.17 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate.

Molecular Properties

Compound Name[(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate
PubChem CID2568555
Molecular FormulaC12H7Cl2NO2S
Molecular Weight300.17 g/mol
Exact Mass298.96
IUPAC Name[(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate
SMILESC[C@H](C#N)OC(=O)c1sc2cc(Cl)ccc2c1Cl
InChIInChI=1S/C12H7Cl2NO2S/c1-6(5-15)17-12(16)11-10(14)8-3-2-7(13)4-9(8)18-11/h2-4,6H,1H3/t6-/m1/s1
InChIKeyGRGFDTOQYIPCQY-ZCFIWIBFSA-N
XLogP4.28
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.17
LogP ≤ 54.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate?
The IUPAC name of [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate (CID 2568555) is [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate?
The canonical SMILES for [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate is C[C@H](C#N)OC(=O)c1sc2cc(Cl)ccc2c1Cl.
What is the InChIKey of [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate?
The InChIKey is GRGFDTOQYIPCQY-ZCFIWIBFSA-N. The full InChI is InChI=1S/C12H7Cl2NO2S/c1-6(5-15)17-12(16)11-10(14)8-3-2-7(13)4-9(8)18-11/h2-4,6H,1H3/t6-/m1/s1.
What are the key properties of [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate?
[(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate has a molecular weight of 300.17 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyanoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 2568555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).