C17H16N2OS — CID 2569722
N-benzo[e][1,3]benzothiazol-2-ylcyclopentanecarboxamide (PubChem CID 2569722) has the molecular formula C17H16N2OS and a molecular weight of 296.39 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-ylcyclopentanecarboxamide.
| Compound Name | N-benzo[e][1,3]benzothiazol-2-ylcyclopentanecarboxamide |
|---|---|
| PubChem CID | 2569722 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-ylcyclopentanecarboxamide |
| SMILES | O=C(Nc1nc2c(ccc3ccccc32)s1)C1CCCC1 |
| InChI | InChI=1S/C17H16N2OS/c20-16(12-6-1-2-7-12)19-17-18-15-13-8-4-3-5-11(13)9-10-14(15)21-17/h3-5,8-10,12H,1-2,6-7H2,(H,18,19,20) |
| InChIKey | RDEAJFBOUPLWFS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |