About 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one
1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one (PubChem CID 2576098) has the molecular formula C15H20N4OS
and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one |
| PubChem CID | 2576098 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one |
| SMILES | Cc1sc2ncnc(NCCCN3CCCC3=O)c2c1C |
| InChI | InChI=1S/C15H20N4OS/c1-10-11(2)21-15-13(10)14(17-9-18-15)16-6-4-8-19-7-3-5-12(19)20/h9H,3-8H2,1-2H3,(H,16,17,18) |
| InChIKey | SEBLKXJVKCMRHF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one?
The IUPAC name of 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one (CID 2576098) is 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one?
The canonical SMILES for 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one is Cc1sc2ncnc(NCCCN3CCCC3=O)c2c1C.
What is the InChIKey of 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one?
The InChIKey is SEBLKXJVKCMRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4OS/c1-10-11(2)21-15-13(10)14(17-9-18-15)16-6-4-8-19-7-3-5-12(19)20/h9H,3-8H2,1-2H3,(H,16,17,18).
What are the key properties of 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one?
1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one has a molecular weight of 304.42 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]pyrrolidin-2-one is sourced from PubChem (CID 2576098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).