C20H23N3O6S — CID 2577669
[2-oxo-2-(propylcarbamoylamino)ethyl] 3-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 2577669) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 3-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 3-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2577669 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 3-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)c1cccc(S(=O)(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C20H23N3O6S/c1-3-12-21-20(26)22-18(24)14-29-19(25)15-8-7-11-17(13-15)30(27,28)23(2)16-9-5-4-6-10-16/h4-11,13H,3,12,14H2,1-2H3,(H2,21,22,24,26) |
| InChIKey | ZVHMFIZCPUYHQC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |