C23H18N6O5 — CID 2582347
N-[5-cyano-7-(3-methoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-4-nitrobenzamide (PubChem CID 2582347) has the molecular formula C23H18N6O5 and a molecular weight of 458.43 g/mol. Its IUPAC name is N-[5-cyano-7-(3-methoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-4-nitrobenzamide.
| Compound Name | N-[5-cyano-7-(3-methoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-4-nitrobenzamide |
|---|---|
| PubChem CID | 2582347 |
| Molecular Formula | C23H18N6O5 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[5-cyano-7-(3-methoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-4-nitrobenzamide |
| SMILES | COCCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)c(C#N)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C23H18N6O5/c1-34-12-4-11-28-20(26-22(30)15-6-8-17(9-7-15)29(32)33)16(14-24)13-18-21(28)25-19-5-2-3-10-27(19)23(18)31/h2-3,5-10,13H,4,11-12H2,1H3/b26-20+ |
| InChIKey | ATAKPTFKLNTNRD-LHLOQNFPSA-N |
| XLogP | 2.21 |
| TPSA | 144.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|