C28H31N5O5 — CID 18532329
(3E,5E)-N-[5-cyano-2-oxo-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-4,6-dimethoxyocta-3,5,7-trienamide (PubChem CID 18532329) has the molecular formula C28H31N5O5 and a molecular weight of 517.59 g/mol. Its IUPAC name is (3E,5E)-N-[5-cyano-2-oxo-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-4,6-dimethoxyocta-3,5,7-trienamide.
| Compound Name | (3E,5E)-N-[5-cyano-2-oxo-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-4,6-dimethoxyocta-3,5,7-trienamide |
|---|---|
| PubChem CID | 18532329 |
| Molecular Formula | C28H31N5O5 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | (3E,5E)-N-[5-cyano-2-oxo-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-4,6-dimethoxyocta-3,5,7-trienamide |
| SMILES | C=C/C(=C\C(=C/CC(=O)/N=c1\c(C#N)cc2c(=O)n3ccccc3nc2n1CCCOC(C)C)OC)OC |
| InChI | InChI=1S/C28H31N5O5/c1-6-21(36-4)17-22(37-5)11-12-25(34)31-26-20(18-29)16-23-27(33(26)14-9-15-38-19(2)3)30-24-10-7-8-13-32(24)28(23)35/h6-8,10-11,13,16-17,19H,1,9,12,14-15H2,2-5H3/b21-17+,22-11+,31-26+ |
| InChIKey | GGHMZHNABFMNDH-PXLGLZSRSA-N |
| XLogP | 3.40 |
| TPSA | 120.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|