C25H24BrN5O3 — CID 18532351
(3E,5Z)-3-bromo-N-[5-cyano-7-(3-ethoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]octa-3,5,7-trienamide (PubChem CID 18532351) has the molecular formula C25H24BrN5O3 and a molecular weight of 522.40 g/mol. Its IUPAC name is (3E,5Z)-3-bromo-N-[5-cyano-7-(3-ethoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]octa-3,5,7-trienamide.
| Compound Name | (3E,5Z)-3-bromo-N-[5-cyano-7-(3-ethoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]octa-3,5,7-trienamide |
|---|---|
| PubChem CID | 18532351 |
| Molecular Formula | C25H24BrN5O3 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | (3E,5Z)-3-bromo-N-[5-cyano-7-(3-ethoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]octa-3,5,7-trienamide |
| SMILES | C=C/C=C\C=C(\Br)CC(=O)/N=c1\c(C#N)cc2c(=O)n3ccccc3nc2n1CCCOCC |
| InChI | InChI=1S/C25H24BrN5O3/c1-3-5-6-10-19(26)16-22(32)29-23-18(17-27)15-20-24(31(23)13-9-14-34-4-2)28-21-11-7-8-12-30(21)25(20)33/h3,5-8,10-12,15H,1,4,9,13-14,16H2,2H3/b6-5-,19-10+,29-23+ |
| InChIKey | MBNHHCGUHAODLY-JTPAIEHZSA-N |
| XLogP | 3.79 |
| TPSA | 101.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|