C21H16ClFN2O6S — CID 2585364
(3-nitrophenyl)methyl 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoate (PubChem CID 2585364) has the molecular formula C21H16ClFN2O6S and a molecular weight of 478.89 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoate.
| Compound Name | (3-nitrophenyl)methyl 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2585364 |
| Molecular Formula | C21H16ClFN2O6S |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | (3-nitrophenyl)methyl 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoate |
| SMILES | CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H16ClFN2O6S/c1-24(16-7-5-15(23)6-8-16)32(29,30)18-9-10-20(22)19(12-18)21(26)31-13-14-3-2-4-17(11-14)25(27)28/h2-12H,13H2,1H3 |
| InChIKey | MZJYWLXQQQMHLG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|