C25H22ClFN2O4S — CID 68620097
tert-butyl 5-[(4-chlorophenyl)methyl-(3-cyanophenyl)sulfonylamino]-2-fluorobenzoate (PubChem CID 68620097) has the molecular formula C25H22ClFN2O4S and a molecular weight of 500.98 g/mol. Its IUPAC name is tert-butyl 5-[(4-chlorophenyl)methyl-(3-cyanophenyl)sulfonylamino]-2-fluorobenzoate.
| Compound Name | tert-butyl 5-[(4-chlorophenyl)methyl-(3-cyanophenyl)sulfonylamino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 68620097 |
| Molecular Formula | C25H22ClFN2O4S |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | tert-butyl 5-[(4-chlorophenyl)methyl-(3-cyanophenyl)sulfonylamino]-2-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(N(Cc2ccc(Cl)cc2)S(=O)(=O)c2cccc(C#N)c2)ccc1F |
| InChI | InChI=1S/C25H22ClFN2O4S/c1-25(2,3)33-24(30)22-14-20(11-12-23(22)27)29(16-17-7-9-19(26)10-8-17)34(31,32)21-6-4-5-18(13-21)15-28/h4-14H,16H2,1-3H3 |
| InChIKey | RQRXYGXACTYYEK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |