C22H24ClN3O4S — CID 68618788
tert-butyl 3-[(4-chlorophenyl)methyl-(1-methylimidazol-4-yl)sulfonylamino]benzoate (PubChem CID 68618788) has the molecular formula C22H24ClN3O4S and a molecular weight of 461.97 g/mol. Its IUPAC name is tert-butyl 3-[(4-chlorophenyl)methyl-(1-methylimidazol-4-yl)sulfonylamino]benzoate.
| Compound Name | tert-butyl 3-[(4-chlorophenyl)methyl-(1-methylimidazol-4-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 68618788 |
| Molecular Formula | C22H24ClN3O4S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | tert-butyl 3-[(4-chlorophenyl)methyl-(1-methylimidazol-4-yl)sulfonylamino]benzoate |
| SMILES | Cn1cnc(S(=O)(=O)N(Cc2ccc(Cl)cc2)c2cccc(C(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C22H24ClN3O4S/c1-22(2,3)30-21(27)17-6-5-7-19(12-17)26(13-16-8-10-18(23)11-9-16)31(28,29)20-14-25(4)15-24-20/h5-12,14-15H,13H2,1-4H3 |
| InChIKey | RFMAOUIHJGHTLB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |