C22H23ClN4O3S — CID 66648351
3-[(4-chlorophenyl)methyl-(1-methylimidazol-4-yl)sulfonylamino]-N-cyclobutylbenzamide (PubChem CID 66648351) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl-(1-methylimidazol-4-yl)sulfonylamino]-N-cyclobutylbenzamide.
| Compound Name | 3-[(4-chlorophenyl)methyl-(1-methylimidazol-4-yl)sulfonylamino]-N-cyclobutylbenzamide |
|---|---|
| PubChem CID | 66648351 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl-(1-methylimidazol-4-yl)sulfonylamino]-N-cyclobutylbenzamide |
| SMILES | Cn1cnc(S(=O)(=O)N(Cc2ccc(Cl)cc2)c2cccc(C(=O)NC3CCC3)c2)c1 |
| InChI | InChI=1S/C22H23ClN4O3S/c1-26-14-21(24-15-26)31(29,30)27(13-16-8-10-18(23)11-9-16)20-7-2-4-17(12-20)22(28)25-19-5-3-6-19/h2,4,7-12,14-15,19H,3,5-6,13H2,1H3,(H,25,28) |
| InChIKey | HDYJZMZMYHRRFX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |