C19H17Cl2N5O3S — CID 2595582
(2S)-N-(3,5-dichloro-2-pyridinyl)-2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 2595582) has the molecular formula C19H17Cl2N5O3S and a molecular weight of 466.35 g/mol. Its IUPAC name is (2S)-N-(3,5-dichloro-2-pyridinyl)-2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(3,5-dichloro-2-pyridinyl)-2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 2595582 |
| Molecular Formula | C19H17Cl2N5O3S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | (2S)-N-(3,5-dichloro-2-pyridinyl)-2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C[C@H](Sc1nnc([C@@H]2COc3ccccc3O2)n1C)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2N5O3S/c1-10(18(27)23-16-12(21)7-11(20)8-22-16)30-19-25-24-17(26(19)2)15-9-28-13-5-3-4-6-14(13)29-15/h3-8,10,15H,9H2,1-2H3,(H,22,23,27)/t10-,15-/m0/s1 |
| InChIKey | KMWLHFWFNAOSEN-BONVTDFDSA-N |
| XLogP | 4.15 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |