C21H20Cl2N4O3S — CID 41208235
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 41208235) has the molecular formula C21H20Cl2N4O3S and a molecular weight of 479.39 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 41208235 |
| Molecular Formula | C21H20Cl2N4O3S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C[C@@H](NC(=O)CSc1nnc([C@@H]2COc3ccccc3O2)n1C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N4O3S/c1-12(14-8-7-13(22)9-15(14)23)24-19(28)11-31-21-26-25-20(27(21)2)18-10-29-16-5-3-4-6-17(16)30-18/h3-9,12,18H,10-11H2,1-2H3,(H,24,28)/t12-,18+/m1/s1 |
| InChIKey | CQCARLRJFQXDMJ-XIKOKIGWSA-N |
| XLogP | 4.60 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |