C6H10O3 — CID 259712
(R)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 259712) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (R)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 259712 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (4R)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(OC[C@@H](O1)C=O)C |
| InChI | InChI=1S/C6H10O3/c1-6(2)8-4-5(3-7)9-6/h3,5H,4H2,1-2H3/t5-/m0/s1 |
| InChIKey | YSGPYVWACGYQDJ-YFKPBYRVSA-N |
| XLogP | 0.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | 119 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|