C21H17N3O5 — CID 2597444
[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2597444) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2597444 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](OC(=O)[C@H](C)N1C(=O)c2ccccc2C1=O)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C21H17N3O5/c1-12(24-19(26)15-8-4-5-9-16(15)20(24)27)21(28)29-13(2)18(25)23-17-10-6-3-7-14(17)11-22/h3-10,12-13H,1-2H3,(H,23,25)/t12-,13+/m0/s1 |
| InChIKey | QZBDTBJOEQXBJX-QWHCGFSZSA-N |
| XLogP | 2.11 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|