C21H26FNO4 — CID 26007251
ethyl 4-[(2S)-3-[[(1S)-1-(4-fluorophenyl)ethyl]-methylamino]-2-hydroxypropoxy]benzoate (PubChem CID 26007251) has the molecular formula C21H26FNO4 and a molecular weight of 375.44 g/mol. Its IUPAC name is ethyl 4-[(2S)-3-[[(1S)-1-(4-fluorophenyl)ethyl]-methylamino]-2-hydroxypropoxy]benzoate.
| Compound Name | ethyl 4-[(2S)-3-[[(1S)-1-(4-fluorophenyl)ethyl]-methylamino]-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 26007251 |
| Molecular Formula | C21H26FNO4 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | ethyl 4-[(2S)-3-[[(1S)-1-(4-fluorophenyl)ethyl]-methylamino]-2-hydroxypropoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OC[C@@H](O)CN(C)[C@@H](C)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H26FNO4/c1-4-26-21(25)17-7-11-20(12-8-17)27-14-19(24)13-23(3)15(2)16-5-9-18(22)10-6-16/h5-12,15,19,24H,4,13-14H2,1-3H3/t15-,19-/m0/s1 |
| InChIKey | TUVLYSBOWWNEJR-KXBFYZLASA-N |
| XLogP | 3.44 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |