C16H22BrN3O3 — CID 26008291
(2R)-2-acetamido-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-methylbutanamide (PubChem CID 26008291) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is (2R)-2-acetamido-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2R)-2-acetamido-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 26008291 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (2R)-2-acetamido-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-methylbutanamide |
| SMILES | CC(=O)N[C@@H](C(=O)NCC(=O)Nc1ccc(Br)cc1C)C(C)C |
| InChI | InChI=1S/C16H22BrN3O3/c1-9(2)15(19-11(4)21)16(23)18-8-14(22)20-13-6-5-12(17)7-10(13)3/h5-7,9,15H,8H2,1-4H3,(H,18,23)(H,19,21)(H,20,22)/t15-/m1/s1 |
| InChIKey | SYTPVFOYHVNFOT-OAHLLOKOSA-N |
| XLogP | 1.97 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |