C15H25N3O4 — CID 26010728
[2-[[(2S)-octan-2-yl]amino]-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 26010728) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is [2-[[(2S)-octan-2-yl]amino]-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[[(2S)-octan-2-yl]amino]-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 26010728 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | [2-[[(2S)-octan-2-yl]amino]-2-oxoethyl] 5-amino-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCCCCC[C@H](C)NC(=O)COC(=O)c1c(C)noc1N |
| InChI | InChI=1S/C15H25N3O4/c1-4-5-6-7-8-10(2)17-12(19)9-21-15(20)13-11(3)18-22-14(13)16/h10H,4-9,16H2,1-3H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | XHGAMPRFOSMTJJ-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|