C21H24N4O5S — CID 26031798
4-[4-(benzenesulfonamido)piperidin-1-yl]-N-cyclopropyl-3-nitrobenzamide (PubChem CID 26031798) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-[4-(benzenesulfonamido)piperidin-1-yl]-N-cyclopropyl-3-nitrobenzamide.
| Compound Name | 4-[4-(benzenesulfonamido)piperidin-1-yl]-N-cyclopropyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26031798 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-[4-(benzenesulfonamido)piperidin-1-yl]-N-cyclopropyl-3-nitrobenzamide |
| SMILES | O=C(NC1CC1)c1ccc(N2CCC(NS(=O)(=O)c3ccccc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N4O5S/c26-21(22-16-7-8-16)15-6-9-19(20(14-15)25(27)28)24-12-10-17(11-13-24)23-31(29,30)18-4-2-1-3-5-18/h1-6,9,14,16-17,23H,7-8,10-13H2,(H,22,26) |
| InChIKey | OBVNGHDLSNABGX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|