C19H16N4OS2 — CID 2603353
(2S)-N-(2-cyanophenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propanamide (PubChem CID 2603353) has the molecular formula C19H16N4OS2 and a molecular weight of 380.50 g/mol. Its IUPAC name is (2S)-N-(2-cyanophenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(2-cyanophenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 2603353 |
| Molecular Formula | C19H16N4OS2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (2S)-N-(2-cyanophenyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propanamide |
| SMILES | C[C@H](Sc1ncnc2sc3c(c12)CCC3)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C19H16N4OS2/c1-11(17(24)23-14-7-3-2-5-12(14)9-20)25-18-16-13-6-4-8-15(13)26-19(16)22-10-21-18/h2-3,5,7,10-11H,4,6,8H2,1H3,(H,23,24)/t11-/m0/s1 |
| InChIKey | GANDBHCNMCDBOJ-NSHDSACASA-N |
| XLogP | 4.17 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |