C20H20N4O2S2 — CID 46618436
N-(benzylcarbamoyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propanamide (PubChem CID 46618436) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propanamide.
| Compound Name | N-(benzylcarbamoyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 46618436 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-(benzylcarbamoyl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propanamide |
| SMILES | CC(Sc1ncnc2sc3c(c12)CCC3)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H20N4O2S2/c1-12(17(25)24-20(26)21-10-13-6-3-2-4-7-13)27-18-16-14-8-5-9-15(14)28-19(16)23-11-22-18/h2-4,6-7,11-12H,5,8-10H2,1H3,(H2,21,24,25,26) |
| InChIKey | PTZBRBLOLHEZRU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |