C21H23N3OS2 — CID 4809706
N-(4-phenylbutan-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide (PubChem CID 4809706) has the molecular formula C21H23N3OS2 and a molecular weight of 397.57 g/mol. Its IUPAC name is N-(4-phenylbutan-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide.
| Compound Name | N-(4-phenylbutan-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 4809706 |
| Molecular Formula | C21H23N3OS2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-(4-phenylbutan-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
| SMILES | CC(CCc1ccccc1)NC(=O)CSc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C21H23N3OS2/c1-14(10-11-15-6-3-2-4-7-15)24-18(25)12-26-20-19-16-8-5-9-17(16)27-21(19)23-13-22-20/h2-4,6-7,13-14H,5,8-12H2,1H3,(H,24,25) |
| InChIKey | KGBSBDVWJGRLCV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |