C21H19N3O2S2 — CID 8577687
N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide (PubChem CID 8577687) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide.
| Compound Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 8577687 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
| SMILES | C[C@@H](NC(=O)CSc1ncnc2sc3c(c12)CCC3)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H19N3O2S2/c1-12(16-9-13-5-2-3-7-15(13)26-16)24-18(25)10-27-20-19-14-6-4-8-17(14)28-21(19)23-11-22-20/h2-3,5,7,9,11-12H,4,6,8,10H2,1H3,(H,24,25)/t12-/m1/s1 |
| InChIKey | SSBWBNVVWONOAM-GFCCVEGCSA-N |
| XLogP | 4.90 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |