C22H21NO4 — CID 26037093
(2R,3S)-2-methyl-N-(2-naphthalen-2-yloxyethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 26037093) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-(2-naphthalen-2-yloxyethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-(2-naphthalen-2-yloxyethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 26037093 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2R,3S)-2-methyl-N-(2-naphthalen-2-yloxyethyl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | C[C@H]1Oc2ccccc2O[C@@H]1C(=O)NCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H21NO4/c1-15-21(27-20-9-5-4-8-19(20)26-15)22(24)23-12-13-25-18-11-10-16-6-2-3-7-17(16)14-18/h2-11,14-15,21H,12-13H2,1H3,(H,23,24)/t15-,21+/m1/s1 |
| InChIKey | RVWGCCOJTKAEHX-VFNWGFHPSA-N |
| XLogP | 3.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|