C26H27ClN2O4 — CID 26042056
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[4-(4-methoxybenzoyl)piperidin-1-yl]acetamide (PubChem CID 26042056) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[4-(4-methoxybenzoyl)piperidin-1-yl]acetamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[4-(4-methoxybenzoyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 26042056 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[4-(4-methoxybenzoyl)piperidin-1-yl]acetamide |
| SMILES | COc1ccc(C(=O)C2CCN(CC(=O)NCc3ccc(-c4ccc(Cl)cc4)o3)CC2)cc1 |
| InChI | InChI=1S/C26H27ClN2O4/c1-32-22-8-4-19(5-9-22)26(31)20-12-14-29(15-13-20)17-25(30)28-16-23-10-11-24(33-23)18-2-6-21(27)7-3-18/h2-11,20H,12-17H2,1H3,(H,28,30) |
| InChIKey | ASVCIHKPPQGQCA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |