C23H24N6OS — CID 26081756
3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-(4-pyrazol-1-ylphenyl)ethyl]propanamide (PubChem CID 26081756) has the molecular formula C23H24N6OS and a molecular weight of 432.55 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-(4-pyrazol-1-ylphenyl)ethyl]propanamide.
| Compound Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-(4-pyrazol-1-ylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 26081756 |
| Molecular Formula | C23H24N6OS |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-(4-pyrazol-1-ylphenyl)ethyl]propanamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)NCCc2ccc(-n3cccn3)cc2)cc1 |
| InChI | InChI=1S/C23H24N6OS/c1-17-3-7-19(8-4-17)22-26-27-23(31)28(22)16-12-21(30)24-14-11-18-5-9-20(10-6-18)29-15-2-13-25-29/h2-10,13,15H,11-12,14,16H2,1H3,(H,24,30)(H,27,31) |
| InChIKey | ISWNHKOQLYYCNO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|