C21H22F2N4O2S — CID 55388771
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide (PubChem CID 55388771) has the molecular formula C21H22F2N4O2S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 55388771 |
| Molecular Formula | C21H22F2N4O2S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)NCCc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H22F2N4O2S/c1-14-2-6-16(7-3-14)19-25-26-21(30)27(19)13-11-18(28)24-12-10-15-4-8-17(9-5-15)29-20(22)23/h2-9,20H,10-13H2,1H3,(H,24,28)(H,26,30) |
| InChIKey | BCFUVCCHLCVEFE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|