C18H17FN2O3 — CID 2611917
[2-oxo-2-(prop-2-enylamino)ethyl] 2-(4-fluoroanilino)benzoate (PubChem CID 2611917) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 2-(4-fluoroanilino)benzoate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-(4-fluoroanilino)benzoate |
|---|---|
| PubChem CID | 2611917 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-(4-fluoroanilino)benzoate |
| SMILES | C=CCNC(=O)COC(=O)c1ccccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN2O3/c1-2-11-20-17(22)12-24-18(23)15-5-3-4-6-16(15)21-14-9-7-13(19)8-10-14/h2-10,21H,1,11-12H2,(H,20,22) |
| InChIKey | VDQFQMVPEMLNTN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|